C21H15F5N6O3 — CID 71488172
1-ethyl-3-[5-fluoro-4-pyrazol-1-yl-6-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1H-benzimidazol-2-yl]urea (PubChem CID 71488172) has the molecular formula C21H15F5N6O3 and a molecular weight of 494.38 g/mol. Its IUPAC name is 1-ethyl-3-[5-fluoro-4-pyrazol-1-yl-6-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1H-benzimidazol-2-yl]urea.
| Compound Name | 1-ethyl-3-[5-fluoro-4-pyrazol-1-yl-6-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1H-benzimidazol-2-yl]urea |
|---|---|
| PubChem CID | 71488172 |
| Molecular Formula | C21H15F5N6O3 |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 1-ethyl-3-[5-fluoro-4-pyrazol-1-yl-6-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1H-benzimidazol-2-yl]urea |
| SMILES | CCNC(=O)Nc1nc2c(-n3cccn3)c(F)c(-c3ccc4c(c3)OC(F)(F)C(F)(F)O4)cc2[nH]1 |
| InChI | InChI=1S/C21H15F5N6O3/c1-2-27-19(33)31-18-29-12-9-11(15(22)17(16(12)30-18)32-7-3-6-28-32)10-4-5-13-14(8-10)35-21(25,26)20(23,24)34-13/h3-9H,2H2,1H3,(H3,27,29,30,31,33) |
| InChIKey | JBMINXRUQRSODC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|