C9H13FN2O2S — CID 71488444
(3aR,5R,6R,7S,7aR)-5-ethenyl-7-fluoro-2-(methylamino)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-6-ol (PubChem CID 71488444) has the molecular formula C9H13FN2O2S and a molecular weight of 232.28 g/mol. Its IUPAC name is (3aR,5R,6R,7S,7aR)-5-ethenyl-7-fluoro-2-(methylamino)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-6-ol.
| Compound Name | (3aR,5R,6R,7S,7aR)-5-ethenyl-7-fluoro-2-(methylamino)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-6-ol |
|---|---|
| PubChem CID | 71488444 |
| Molecular Formula | C9H13FN2O2S |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (3aR,5R,6R,7S,7aR)-5-ethenyl-7-fluoro-2-(methylamino)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-6-ol |
| SMILES | C=C[C@H]1O[C@@H]2SC(NC)=N[C@@H]2[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C9H13FN2O2S/c1-3-4-7(13)5(10)6-8(14-4)15-9(11-2)12-6/h3-8,13H,1H2,2H3,(H,11,12)/t4-,5+,6-,7-,8-/m1/s1 |
| InChIKey | FJVYFCDMNXTPNV-OZRXBMAMSA-N |
| XLogP | 0.29 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|