C20H26F3IN2O4 — CID 71491103
[(2R)-1,1,1-trifluoropropan-2-yl] 4-[4-[(3-iodo-4-pyridinyl)oxy]cyclohexyl]oxypiperidine-1-carboxylate (PubChem CID 71491103) has the molecular formula C20H26F3IN2O4 and a molecular weight of 542.34 g/mol. Its IUPAC name is [(2R)-1,1,1-trifluoropropan-2-yl] 4-[4-[(3-iodo-4-pyridinyl)oxy]cyclohexyl]oxypiperidine-1-carboxylate.
| Compound Name | [(2R)-1,1,1-trifluoropropan-2-yl] 4-[4-[(3-iodo-4-pyridinyl)oxy]cyclohexyl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 71491103 |
| Molecular Formula | C20H26F3IN2O4 |
| Molecular Weight | 542.34 g/mol |
| Exact Mass | 542.09 |
| IUPAC Name | [(2R)-1,1,1-trifluoropropan-2-yl] 4-[4-[(3-iodo-4-pyridinyl)oxy]cyclohexyl]oxypiperidine-1-carboxylate |
| SMILES | C[C@@H](OC(=O)N1CCC(OC2CCC(Oc3ccncc3I)CC2)CC1)C(F)(F)F |
| InChI | InChI=1S/C20H26F3IN2O4/c1-13(20(21,22)23)28-19(27)26-10-7-16(8-11-26)29-14-2-4-15(5-3-14)30-18-6-9-25-12-17(18)24/h6,9,12-16H,2-5,7-8,10-11H2,1H3/t13-,14?,15?/m1/s1 |
| InChIKey | DXFCWDAZVNTTLN-WLYUNCDWSA-N |
| XLogP | 4.94 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.34 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|