C41H53N3O5 — CID 71491457
[1-[9-[[(2R)-2-hydroxy-2-(2-oxo-1H-quinolin-4-yl)ethyl]amino]nonyl]piperidin-4-yl]methyl 2-hydroxy-2,3-diphenylpropanoate (PubChem CID 71491457) has the molecular formula C41H53N3O5 and a molecular weight of 667.89 g/mol. Its IUPAC name is [1-[9-[[(2R)-2-hydroxy-2-(2-oxo-1H-quinolin-4-yl)ethyl]amino]nonyl]piperidin-4-yl]methyl 2-hydroxy-2,3-diphenylpropanoate.
| Compound Name | [1-[9-[[(2R)-2-hydroxy-2-(2-oxo-1H-quinolin-4-yl)ethyl]amino]nonyl]piperidin-4-yl]methyl 2-hydroxy-2,3-diphenylpropanoate |
|---|---|
| PubChem CID | 71491457 |
| Molecular Formula | C41H53N3O5 |
| Molecular Weight | 667.89 g/mol |
| Exact Mass | 667.40 |
| IUPAC Name | [1-[9-[[(2R)-2-hydroxy-2-(2-oxo-1H-quinolin-4-yl)ethyl]amino]nonyl]piperidin-4-yl]methyl 2-hydroxy-2,3-diphenylpropanoate |
| SMILES | O=C(OCC1CCN(CCCCCCCCCNC[C@H](O)c2cc(=O)[nH]c3ccccc23)CC1)C(O)(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H53N3O5/c45-38(36-28-39(46)43-37-21-13-12-20-35(36)37)30-42-24-14-4-2-1-3-5-15-25-44-26-22-33(23-27-44)31-49-40(47)41(48,34-18-10-7-11-19-34)29-32-16-8-6-9-17-32/h6-13,16-21,28,33,38,42,45,48H,1-5,14-15,22-27,29-31H2,(H,43,46)/t38-,41?/m0/s1 |
| InChIKey | UPSMRDHYRIZAFR-OTKZQKHGSA-N |
| XLogP | 6.27 |
| TPSA | 114.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.89 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|