C17H13NO4 — CID 71492274
4-benzyl-3-methylidene-1-oxa-4-azaspiro[5.5]undeca-7,10-diene-2,5,9-trione (PubChem CID 71492274) has the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. Its IUPAC name is 4-benzyl-3-methylidene-1-oxa-4-azaspiro[5.5]undeca-7,10-diene-2,5,9-trione.
| Compound Name | 4-benzyl-3-methylidene-1-oxa-4-azaspiro[5.5]undeca-7,10-diene-2,5,9-trione |
|---|---|
| PubChem CID | 71492274 |
| Molecular Formula | C17H13NO4 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 4-benzyl-3-methylidene-1-oxa-4-azaspiro[5.5]undeca-7,10-diene-2,5,9-trione |
| SMILES | C=C1C(=O)OC2(C=CC(=O)C=C2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C17H13NO4/c1-12-15(20)22-17(9-7-14(19)8-10-17)16(21)18(12)11-13-5-3-2-4-6-13/h2-10H,1,11H2 |
| InChIKey | PLEBBDKRJBHVFA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|