C20H16F6N6O — CID 71492986
(Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-methyl-N'-(3-methyl-2-pyridinyl)prop-2-enehydrazide (PubChem CID 71492986) has the molecular formula C20H16F6N6O and a molecular weight of 470.38 g/mol. Its IUPAC name is (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-methyl-N'-(3-methyl-2-pyridinyl)prop-2-enehydrazide.
| Compound Name | (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-methyl-N'-(3-methyl-2-pyridinyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 71492986 |
| Molecular Formula | C20H16F6N6O |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-methyl-N'-(3-methyl-2-pyridinyl)prop-2-enehydrazide |
| SMILES | Cc1cccnc1N(C)NC(=O)/C=C\n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C20H16F6N6O/c1-12-4-3-6-27-18(12)31(2)29-16(33)5-7-32-11-28-17(30-32)13-8-14(19(21,22)23)10-15(9-13)20(24,25)26/h3-11H,1-2H3,(H,29,33)/b7-5- |
| InChIKey | YFTYASDCIKQXIS-ALCCZGGFSA-N |
| XLogP | 4.32 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|