C29H26ClFN8O2 — CID 71493474
N-[1-[[1-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]triazol-4-yl]methyl]piperidin-4-ylidene]hydroxylamine (PubChem CID 71493474) has the molecular formula C29H26ClFN8O2 and a molecular weight of 573.03 g/mol. Its IUPAC name is N-[1-[[1-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]triazol-4-yl]methyl]piperidin-4-ylidene]hydroxylamine.
| Compound Name | N-[1-[[1-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]triazol-4-yl]methyl]piperidin-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 71493474 |
| Molecular Formula | C29H26ClFN8O2 |
| Molecular Weight | 573.03 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | N-[1-[[1-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]triazol-4-yl]methyl]piperidin-4-ylidene]hydroxylamine |
| SMILES | ON=C1CCN(Cc2cn(-c3ccc4ncnc(Nc5ccc(OCc6cccc(F)c6)c(Cl)c5)c4c3)nn2)CC1 |
| InChI | InChI=1S/C29H26ClFN8O2/c30-26-13-22(4-7-28(26)41-17-19-2-1-3-20(31)12-19)34-29-25-14-24(5-6-27(25)32-18-33-29)39-16-23(35-37-39)15-38-10-8-21(36-40)9-11-38/h1-7,12-14,16,18,40H,8-11,15,17H2,(H,32,33,34) |
| InChIKey | VFSGHGNNDSKIQH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.03 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|