C17H27NO9 — CID 71497405
(4S,5S)-5-acetamido-5-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxopentanoic acid (PubChem CID 71497405) has the molecular formula C17H27NO9 and a molecular weight of 389.40 g/mol. Its IUPAC name is (4S,5S)-5-acetamido-5-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxopentanoic acid.
| Compound Name | (4S,5S)-5-acetamido-5-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxopentanoic acid |
|---|---|
| PubChem CID | 71497405 |
| Molecular Formula | C17H27NO9 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | (4S,5S)-5-acetamido-5-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxopentanoic acid |
| SMILES | CC(=O)N[C@H]([C@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1)[C@@H](O)CC(=O)C(=O)O |
| InChI | InChI=1S/C17H27NO9/c1-8(19)18-12(9(20)6-10(21)15(22)23)14-13(26-17(4,5)27-14)11-7-24-16(2,3)25-11/h9,11-14,20H,6-7H2,1-5H3,(H,18,19)(H,22,23)/t9-,11+,12-,13+,14+/m0/s1 |
| InChIKey | SBFULOHUSGGSSE-JWZAGAIZSA-N |
| XLogP | -0.43 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|