C19H23NO4S — CID 71497480
N-[2-(3,4-dimethoxy-2-prop-2-enylphenyl)ethyl]benzenesulfonamide (PubChem CID 71497480) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxy-2-prop-2-enylphenyl)ethyl]benzenesulfonamide.
| Compound Name | N-[2-(3,4-dimethoxy-2-prop-2-enylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71497480 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | N-[2-(3,4-dimethoxy-2-prop-2-enylphenyl)ethyl]benzenesulfonamide |
| SMILES | C=CCc1c(CCNS(=O)(=O)c2ccccc2)ccc(OC)c1OC |
| InChI | InChI=1S/C19H23NO4S/c1-4-8-17-15(11-12-18(23-2)19(17)24-3)13-14-20-25(21,22)16-9-6-5-7-10-16/h4-7,9-12,20H,1,8,13-14H2,2-3H3 |
| InChIKey | XVAAGMKVFLFRJK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|