C20H23NO4S — CID 102204458
N-(3,4-dimethoxy-2-prop-2-enylphenyl)-N-prop-2-enylbenzenesulfonamide (PubChem CID 102204458) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is N-(3,4-dimethoxy-2-prop-2-enylphenyl)-N-prop-2-enylbenzenesulfonamide.
| Compound Name | N-(3,4-dimethoxy-2-prop-2-enylphenyl)-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 102204458 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | N-(3,4-dimethoxy-2-prop-2-enylphenyl)-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCc1c(N(CC=C)S(=O)(=O)c2ccccc2)ccc(OC)c1OC |
| InChI | InChI=1S/C20H23NO4S/c1-5-10-17-18(13-14-19(24-3)20(17)25-4)21(15-6-2)26(22,23)16-11-8-7-9-12-16/h5-9,11-14H,1-2,10,15H2,3-4H3 |
| InChIKey | GALOMLBWAMXNLW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|