C16H16ClNO5S2 — CID 2566541
N-(4-chlorophenyl)sulfonyl-2-methoxy-N-prop-2-enylbenzenesulfonamide (PubChem CID 2566541) has the molecular formula C16H16ClNO5S2 and a molecular weight of 401.89 g/mol. Its IUPAC name is N-(4-chlorophenyl)sulfonyl-2-methoxy-N-prop-2-enylbenzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)sulfonyl-2-methoxy-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 2566541 |
| Molecular Formula | C16H16ClNO5S2 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | N-(4-chlorophenyl)sulfonyl-2-methoxy-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(S(=O)(=O)c1ccc(Cl)cc1)S(=O)(=O)c1ccccc1OC |
| InChI | InChI=1S/C16H16ClNO5S2/c1-3-12-18(24(19,20)14-10-8-13(17)9-11-14)25(21,22)16-7-5-4-6-15(16)23-2/h3-11H,1,12H2,2H3 |
| InChIKey | ASKDVFMUFSFIMO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|