C23H19BrFN3O3 — CID 71498420
(4E)-5-(4-bromophenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-[3-(1H-imidazol-2-yl)propyl]pyrrolidine-2,3-dione (PubChem CID 71498420) has the molecular formula C23H19BrFN3O3 and a molecular weight of 484.33 g/mol. Its IUPAC name is (4E)-5-(4-bromophenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-[3-(1H-imidazol-2-yl)propyl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(4-bromophenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-[3-(1H-imidazol-2-yl)propyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 71498420 |
| Molecular Formula | C23H19BrFN3O3 |
| Molecular Weight | 484.33 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | (4E)-5-(4-bromophenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-[3-(1H-imidazol-2-yl)propyl]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCCc2ncc[nH]2)C(c2ccc(Br)cc2)/C1=C(\O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H19BrFN3O3/c24-16-7-3-14(4-8-16)20-19(21(29)15-5-9-17(25)10-6-15)22(30)23(31)28(20)13-1-2-18-26-11-12-27-18/h3-12,20,29H,1-2,13H2,(H,26,27)/b21-19+ |
| InChIKey | VYFIITLKBKRVFU-XUTLUUPISA-N |
| XLogP | 4.37 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|