C23H25N5O3 — CID 71498615
5-[[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]amino]pyridine-3-carbonitrile (PubChem CID 71498615) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is 5-[[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]amino]pyridine-3-carbonitrile.
| Compound Name | 5-[[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 71498615 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 5-[[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]amino]pyridine-3-carbonitrile |
| SMILES | COc1cc2c(Nc3cncc(C#N)c3)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C23H25N5O3/c1-29-22-12-19-20(27-18-11-17(14-24)15-25-16-18)3-4-26-21(19)13-23(22)31-8-2-5-28-6-9-30-10-7-28/h3-4,11-13,15-16H,2,5-10H2,1H3,(H,26,27) |
| InChIKey | WSGBKLJZQOSUGM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 92.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|