C17H18BrFN2O4 — CID 71499388
5-[(3-bromo-5-fluorophenoxy)methyl]-N-(2,2-dimethoxyethyl)pyridine-2-carboxamide (PubChem CID 71499388) has the molecular formula C17H18BrFN2O4 and a molecular weight of 413.24 g/mol. Its IUPAC name is 5-[(3-bromo-5-fluorophenoxy)methyl]-N-(2,2-dimethoxyethyl)pyridine-2-carboxamide.
| Compound Name | 5-[(3-bromo-5-fluorophenoxy)methyl]-N-(2,2-dimethoxyethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 71499388 |
| Molecular Formula | C17H18BrFN2O4 |
| Molecular Weight | 413.24 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 5-[(3-bromo-5-fluorophenoxy)methyl]-N-(2,2-dimethoxyethyl)pyridine-2-carboxamide |
| SMILES | COC(CNC(=O)c1ccc(COc2cc(F)cc(Br)c2)cn1)OC |
| InChI | InChI=1S/C17H18BrFN2O4/c1-23-16(24-2)9-21-17(22)15-4-3-11(8-20-15)10-25-14-6-12(18)5-13(19)7-14/h3-8,16H,9-10H2,1-2H3,(H,21,22) |
| InChIKey | NPCBGOHBJNXUSZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|