C20H23F3N2O3 — CID 71499487
N-(3-methylbutyl)-5-[2-[3-(trifluoromethoxy)phenoxy]ethyl]pyridine-2-carboxamide (PubChem CID 71499487) has the molecular formula C20H23F3N2O3 and a molecular weight of 396.41 g/mol. Its IUPAC name is N-(3-methylbutyl)-5-[2-[3-(trifluoromethoxy)phenoxy]ethyl]pyridine-2-carboxamide.
| Compound Name | N-(3-methylbutyl)-5-[2-[3-(trifluoromethoxy)phenoxy]ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 71499487 |
| Molecular Formula | C20H23F3N2O3 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | N-(3-methylbutyl)-5-[2-[3-(trifluoromethoxy)phenoxy]ethyl]pyridine-2-carboxamide |
| SMILES | CC(C)CCNC(=O)c1ccc(CCOc2cccc(OC(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C20H23F3N2O3/c1-14(2)8-10-24-19(26)18-7-6-15(13-25-18)9-11-27-16-4-3-5-17(12-16)28-20(21,22)23/h3-7,12-14H,8-11H2,1-2H3,(H,24,26) |
| InChIKey | BWQMZGLZAJEYNX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |