C24H27F3N4O5 — CID 129113322
3-benzyl-N-(3-hydroxypropyl)-5-(methylamino)-2-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]imidazole-4-carboxamide (PubChem CID 129113322) has the molecular formula C24H27F3N4O5 and a molecular weight of 508.50 g/mol. Its IUPAC name is 3-benzyl-N-(3-hydroxypropyl)-5-(methylamino)-2-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]imidazole-4-carboxamide.
| Compound Name | 3-benzyl-N-(3-hydroxypropyl)-5-(methylamino)-2-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 129113322 |
| Molecular Formula | C24H27F3N4O5 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 3-benzyl-N-(3-hydroxypropyl)-5-(methylamino)-2-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]imidazole-4-carboxamide |
| SMILES | CNc1nc(OCCOc2cccc(OC(F)(F)F)c2)n(Cc2ccccc2)c1C(=O)NCCCO |
| InChI | InChI=1S/C24H27F3N4O5/c1-28-21-20(22(33)29-11-6-12-32)31(16-17-7-3-2-4-8-17)23(30-21)35-14-13-34-18-9-5-10-19(15-18)36-24(25,26)27/h2-5,7-10,15,28,32H,6,11-14,16H2,1H3,(H,29,33) |
| InChIKey | FKFUZPPYGBOKKF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|