C19H15ClF3N3O3 — CID 129112600
3-[(4-chlorophenyl)methyl]-5-(methylamino)-2-[3-(trifluoromethoxy)phenoxy]imidazole-4-carbaldehyde (PubChem CID 129112600) has the molecular formula C19H15ClF3N3O3 and a molecular weight of 425.79 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-5-(methylamino)-2-[3-(trifluoromethoxy)phenoxy]imidazole-4-carbaldehyde.
| Compound Name | 3-[(4-chlorophenyl)methyl]-5-(methylamino)-2-[3-(trifluoromethoxy)phenoxy]imidazole-4-carbaldehyde |
|---|---|
| PubChem CID | 129112600 |
| Molecular Formula | C19H15ClF3N3O3 |
| Molecular Weight | 425.79 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-5-(methylamino)-2-[3-(trifluoromethoxy)phenoxy]imidazole-4-carbaldehyde |
| SMILES | CNc1nc(Oc2cccc(OC(F)(F)F)c2)n(Cc2ccc(Cl)cc2)c1C=O |
| InChI | InChI=1S/C19H15ClF3N3O3/c1-24-17-16(11-27)26(10-12-5-7-13(20)8-6-12)18(25-17)28-14-3-2-4-15(9-14)29-19(21,22)23/h2-9,11,24H,10H2,1H3 |
| InChIKey | FEEWMNDRJRZHQI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.79 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|