C23H24ClF3N4O3 — CID 130445796
N-butyl-3-[(4-chlorophenyl)methyl]-5-(methylamino)-2-[3-(trifluoromethoxy)phenoxy]imidazole-4-carboxamide (PubChem CID 130445796) has the molecular formula C23H24ClF3N4O3 and a molecular weight of 496.92 g/mol. Its IUPAC name is N-butyl-3-[(4-chlorophenyl)methyl]-5-(methylamino)-2-[3-(trifluoromethoxy)phenoxy]imidazole-4-carboxamide.
| Compound Name | N-butyl-3-[(4-chlorophenyl)methyl]-5-(methylamino)-2-[3-(trifluoromethoxy)phenoxy]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 130445796 |
| Molecular Formula | C23H24ClF3N4O3 |
| Molecular Weight | 496.92 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | N-butyl-3-[(4-chlorophenyl)methyl]-5-(methylamino)-2-[3-(trifluoromethoxy)phenoxy]imidazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1c(NC)nc(Oc2cccc(OC(F)(F)F)c2)n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H24ClF3N4O3/c1-3-4-12-29-21(32)19-20(28-2)30-22(31(19)14-15-8-10-16(24)11-9-15)33-17-6-5-7-18(13-17)34-23(25,26)27/h5-11,13,28H,3-4,12,14H2,1-2H3,(H,29,32) |
| InChIKey | OKTWPJYVMBPHHM-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.92 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|