C22H26ClN5O3 — CID 129113270
3-[(5-chloro-2-pyridinyl)methyl]-2-(2-ethylphenoxy)-N-(3-hydroxypropyl)-5-(methylamino)imidazole-4-carboxamide (PubChem CID 129113270) has the molecular formula C22H26ClN5O3 and a molecular weight of 443.94 g/mol. Its IUPAC name is 3-[(5-chloro-2-pyridinyl)methyl]-2-(2-ethylphenoxy)-N-(3-hydroxypropyl)-5-(methylamino)imidazole-4-carboxamide.
| Compound Name | 3-[(5-chloro-2-pyridinyl)methyl]-2-(2-ethylphenoxy)-N-(3-hydroxypropyl)-5-(methylamino)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 129113270 |
| Molecular Formula | C22H26ClN5O3 |
| Molecular Weight | 443.94 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 3-[(5-chloro-2-pyridinyl)methyl]-2-(2-ethylphenoxy)-N-(3-hydroxypropyl)-5-(methylamino)imidazole-4-carboxamide |
| SMILES | CCc1ccccc1Oc1nc(NC)c(C(=O)NCCCO)n1Cc1ccc(Cl)cn1 |
| InChI | InChI=1S/C22H26ClN5O3/c1-3-15-7-4-5-8-18(15)31-22-27-20(24-2)19(21(30)25-11-6-12-29)28(22)14-17-10-9-16(23)13-26-17/h4-5,7-10,13,24,29H,3,6,11-12,14H2,1-2H3,(H,25,30) |
| InChIKey | XHHFGAMYJPZYKK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.94 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|