C17H12N2O2S — CID 71499971
2-(1,3-benzothiazol-2-yl)-5-(2-methoxyphenyl)-1,3-oxazole (PubChem CID 71499971) has the molecular formula C17H12N2O2S and a molecular weight of 308.36 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-5-(2-methoxyphenyl)-1,3-oxazole.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-5-(2-methoxyphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 71499971 |
| Molecular Formula | C17H12N2O2S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-5-(2-methoxyphenyl)-1,3-oxazole |
| SMILES | COc1ccccc1-c1cnc(-c2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C17H12N2O2S/c1-20-13-8-4-2-6-11(13)14-10-18-16(21-14)17-19-12-7-3-5-9-15(12)22-17/h2-10H,1H3 |
| InChIKey | DJMQGFRKLSPXTR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |