C21H27FNO+ — CID 71500611
dibenzyl-[(1R,2R,3R)-3-fluoro-2-hydroxycyclohexyl]-methylazanium (PubChem CID 71500611) has the molecular formula C21H27FNO+ and a molecular weight of 328.45 g/mol. Its IUPAC name is dibenzyl-[(1R,2R,3R)-3-fluoro-2-hydroxycyclohexyl]-methylazanium.
| Compound Name | dibenzyl-[(1R,2R,3R)-3-fluoro-2-hydroxycyclohexyl]-methylazanium |
|---|---|
| PubChem CID | 71500611 |
| Molecular Formula | C21H27FNO+ |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | dibenzyl-[(1R,2R,3R)-3-fluoro-2-hydroxycyclohexyl]-methylazanium |
| SMILES | C[N+](Cc1ccccc1)(Cc1ccccc1)[C@@H]1CCC[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C21H27FNO/c1-23(15-17-9-4-2-5-10-17,16-18-11-6-3-7-12-18)20-14-8-13-19(22)21(20)24/h2-7,9-12,19-21,24H,8,13-16H2,1H3/q+1/t19-,20-,21+/m1/s1 |
| InChIKey | LUWMXDCSFMWDQQ-NJYVYQBISA-N |
| XLogP | 4.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|