C15H21NO4 — CID 71501343
2-(1-cyclohexyl-2-nitroethyl)-6-methoxyphenol (PubChem CID 71501343) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-(1-cyclohexyl-2-nitroethyl)-6-methoxyphenol.
| Compound Name | 2-(1-cyclohexyl-2-nitroethyl)-6-methoxyphenol |
|---|---|
| PubChem CID | 71501343 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-(1-cyclohexyl-2-nitroethyl)-6-methoxyphenol |
| SMILES | COc1cccc(C(C[N+](=O)[O-])C2CCCCC2)c1O |
| InChI | InChI=1S/C15H21NO4/c1-20-14-9-5-8-12(15(14)17)13(10-16(18)19)11-6-3-2-4-7-11/h5,8-9,11,13,17H,2-4,6-7,10H2,1H3 |
| InChIKey | HGGWKRDZZWVAHW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|