C21H26N2O4 — CID 71501403
methyl (1S,11S,17R,18S)-18-[(1S)-1-methoxyethyl]-14-oxido-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carboxylate (PubChem CID 71501403) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is methyl (1S,11S,17R,18S)-18-[(1S)-1-methoxyethyl]-14-oxido-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carboxylate.
| Compound Name | methyl (1S,11S,17R,18S)-18-[(1S)-1-methoxyethyl]-14-oxido-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 71501403 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | methyl (1S,11S,17R,18S)-18-[(1S)-1-methoxyethyl]-14-oxido-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carboxylate |
| SMILES | COC(=O)C1=C2Nc3ccccc3[C@]23CC[N+]2([O-])CC[C@H]1[C@H]([C@H](C)OC)C32 |
| InChI | InChI=1S/C21H26N2O4/c1-12(26-2)16-13-8-10-23(25)11-9-21(19(16)23)14-6-4-5-7-15(14)22-18(21)17(13)20(24)27-3/h4-7,12-13,16,19,22H,8-11H2,1-3H3/t12-,13-,16-,19?,21+,23?/m0/s1 |
| InChIKey | FCDPRPCHRKAVFH-RCMBEGQBSA-N |
| XLogP | 2.55 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|