C19H22N2O5 — CID 102192780
(1R,11R,12R,17S)-12-hydroxy-12-[(1S)-1-hydroxyethyl]-14-oxido-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carboxylic acid (PubChem CID 102192780) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is (1R,11R,12R,17S)-12-hydroxy-12-[(1S)-1-hydroxyethyl]-14-oxido-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carboxylic acid.
| Compound Name | (1R,11R,12R,17S)-12-hydroxy-12-[(1S)-1-hydroxyethyl]-14-oxido-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carboxylic acid |
|---|---|
| PubChem CID | 102192780 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (1R,11R,12R,17S)-12-hydroxy-12-[(1S)-1-hydroxyethyl]-14-oxido-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carboxylic acid |
| SMILES | C[C@H](O)[C@]1(O)C[N+]2([O-])CC[C@]34C(=C(C(=O)O)[C@H]1CC32)Nc1ccccc14 |
| InChI | InChI=1S/C19H22N2O5/c1-10(22)19(25)9-21(26)7-6-18-11-4-2-3-5-13(11)20-16(18)15(17(23)24)12(19)8-14(18)21/h2-5,10,12,14,20,22,25H,6-9H2,1H3,(H,23,24)/t10-,12+,14?,18+,19+,21?/m0/s1 |
| InChIKey | JAPKERJUTMYYDE-PJPJTYTRSA-N |
| XLogP | 0.92 |
| TPSA | 112.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|