C20H25N2O3+ — CID 11530935
(1R,11S,12S,17S)-12-[(1S)-1-hydroxyethyl]-14-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carboxylic acid (PubChem CID 11530935) has the molecular formula C20H25N2O3+ and a molecular weight of 341.43 g/mol. Its IUPAC name is (1R,11S,12S,17S)-12-[(1S)-1-hydroxyethyl]-14-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carboxylic acid.
| Compound Name | (1R,11S,12S,17S)-12-[(1S)-1-hydroxyethyl]-14-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carboxylic acid |
|---|---|
| PubChem CID | 11530935 |
| Molecular Formula | C20H25N2O3+ |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | (1R,11S,12S,17S)-12-[(1S)-1-hydroxyethyl]-14-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carboxylic acid |
| SMILES | C[C@H](O)[C@@H]1C[N+]2(C)CC[C@]34C(=C(C(=O)O)[C@H]1C[C@@H]32)Nc1ccccc14 |
| InChI | InChI=1S/C20H24N2O3/c1-11(23)13-10-22(2)8-7-20-14-5-3-4-6-15(14)21-18(20)17(19(24)25)12(13)9-16(20)22/h3-6,11-13,16,21,23H,7-10H2,1-2H3/p+1/t11-,12-,13-,16-,20+,22?/m0/s1 |
| InChIKey | ZGMJQMUGVPSZML-AMLRROLDSA-O |
| XLogP | 1.94 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|