C21H27N2O4+ — CID 15939812
(1R,11S,12R,14S,17S)-12-[(1R)-1-hydroxyethyl]-6-methoxy-14-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carboxylic acid (PubChem CID 15939812) has the molecular formula C21H27N2O4+ and a molecular weight of 371.46 g/mol. Its IUPAC name is (1R,11S,12R,14S,17S)-12-[(1R)-1-hydroxyethyl]-6-methoxy-14-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carboxylic acid.
| Compound Name | (1R,11S,12R,14S,17S)-12-[(1R)-1-hydroxyethyl]-6-methoxy-14-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carboxylic acid |
|---|---|
| PubChem CID | 15939812 |
| Molecular Formula | C21H27N2O4+ |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | (1R,11S,12R,14S,17S)-12-[(1R)-1-hydroxyethyl]-6-methoxy-14-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carboxylic acid |
| SMILES | COc1cccc2c1NC1=C(C(=O)O)[C@H]3C[C@H]4[C@]12CC[N@@+]4(C)C[C@@H]3[C@@H](C)O |
| InChI | InChI=1S/C21H26N2O4/c1-11(24)13-10-23(2)8-7-21-14-5-4-6-15(27-3)18(14)22-19(21)17(20(25)26)12(13)9-16(21)23/h4-6,11-13,16,22,24H,7-10H2,1-3H3/p+1/t11-,12+,13-,16+,21-,23+/m1/s1 |
| InChIKey | BHQXVMWDDRLGHR-LFKIPOBKSA-O |
| XLogP | 1.95 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|