C21H25N2O2+ — CID 7001883
(1S,11S,12Z,17S)-12-ethylidene-6-methoxy-14-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carbaldehyde (PubChem CID 7001883) has the molecular formula C21H25N2O2+ and a molecular weight of 337.44 g/mol. Its IUPAC name is (1S,11S,12Z,17S)-12-ethylidene-6-methoxy-14-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carbaldehyde.
| Compound Name | (1S,11S,12Z,17S)-12-ethylidene-6-methoxy-14-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carbaldehyde |
|---|---|
| PubChem CID | 7001883 |
| Molecular Formula | C21H25N2O2+ |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (1S,11S,12Z,17S)-12-ethylidene-6-methoxy-14-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carbaldehyde |
| SMILES | C/C=C1\C[N+]2(C)CC[C@@]34C(=C(C=O)[C@H]1C[C@@H]32)Nc1c(OC)cccc14 |
| InChI | InChI=1S/C21H24N2O2/c1-4-13-11-23(2)9-8-21-16-6-5-7-17(25-3)19(16)22-20(21)15(12-24)14(13)10-18(21)23/h4-7,12,14,18H,8-11H2,1-3H3/p+1/b13-4+/t14-,18-,21-,23?/m0/s1 |
| InChIKey | RYFUCGCTWTVHMS-HDKSMTHLSA-O |
| XLogP | 3.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|