C20H23IN2O2 — CID 71966242
(1R,11S,17S)-12-ethylidene-6-hydroxy-14-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carbaldehyde iodide (PubChem CID 71966242) has the molecular formula C20H23IN2O2 and a molecular weight of 450.32 g/mol. Its IUPAC name is (1R,11S,17S)-12-ethylidene-6-hydroxy-14-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carbaldehyde iodide.
| Compound Name | (1R,11S,17S)-12-ethylidene-6-hydroxy-14-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carbaldehyde iodide |
|---|---|
| PubChem CID | 71966242 |
| Molecular Formula | C20H23IN2O2 |
| Molecular Weight | 450.32 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | (1R,11S,17S)-12-ethylidene-6-hydroxy-14-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carbaldehyde iodide |
| SMILES | CC=C1C[N+]2(C)CC[C@]34C(=C(C=O)[C@H]1C[C@@H]32)Nc1c(O)cccc14.[I-] |
| InChI | InChI=1S/C20H22N2O2.HI/c1-3-12-10-22(2)8-7-20-15-5-4-6-16(24)18(15)21-19(20)14(11-23)13(12)9-17(20)22;/h3-6,11,13,17H,7-10H2,1-2H3,(H-,21,23,24);1H/t13-,17-,20+,22?;/m0./s1 |
| InChIKey | AUEXYNCBZNPPCZ-JFMWMCIFSA-N |
| XLogP | -0.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.32 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|