C29H31N2O5+ — CID 125429201
(1R,11S,12E,14S,17S)-14-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]-12-ethylidene-6-hydroxy-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carbaldehyde (PubChem CID 125429201) has the molecular formula C29H31N2O5+ and a molecular weight of 487.58 g/mol. Its IUPAC name is (1R,11S,12E,14S,17S)-14-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]-12-ethylidene-6-hydroxy-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carbaldehyde.
| Compound Name | (1R,11S,12E,14S,17S)-14-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]-12-ethylidene-6-hydroxy-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carbaldehyde |
|---|---|
| PubChem CID | 125429201 |
| Molecular Formula | C29H31N2O5+ |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | (1R,11S,12E,14S,17S)-14-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]-12-ethylidene-6-hydroxy-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carbaldehyde |
| SMILES | C/C=C1/C[N@+]2(CC(=O)c3ccc(OC)c(OC)c3)CC[C@]34C(=C(C=O)[C@H]1C[C@@H]32)Nc1c(O)cccc14 |
| InChI | InChI=1S/C29H30N2O5/c1-4-17-14-31(15-23(34)18-8-9-24(35-2)25(12-18)36-3)11-10-29-21-6-5-7-22(33)27(21)30-28(29)20(16-32)19(17)13-26(29)31/h4-9,12,16,19,26H,10-11,13-15H2,1-3H3,(H-,30,32,33)/p+1/b17-4-/t19-,26-,29+,31-/m0/s1 |
| InChIKey | OGJVDDKSNFNIPQ-VWJITSHSSA-O |
| XLogP | 3.98 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|