C24H30Cl2N6O3S — CID 71502932
[6-(3,4-dichloroanilino)-5-methylpyrimidin-4-yl]-[4-(5-methylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)piperidin-1-yl]methanone (PubChem CID 71502932) has the molecular formula C24H30Cl2N6O3S and a molecular weight of 553.52 g/mol. Its IUPAC name is [6-(3,4-dichloroanilino)-5-methylpyrimidin-4-yl]-[4-(5-methylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)piperidin-1-yl]methanone.
| Compound Name | [6-(3,4-dichloroanilino)-5-methylpyrimidin-4-yl]-[4-(5-methylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 71502932 |
| Molecular Formula | C24H30Cl2N6O3S |
| Molecular Weight | 553.52 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | [6-(3,4-dichloroanilino)-5-methylpyrimidin-4-yl]-[4-(5-methylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)piperidin-1-yl]methanone |
| SMILES | Cc1c(Nc2ccc(Cl)c(Cl)c2)ncnc1C(=O)N1CCC(N2CC3CN(S(C)(=O)=O)CC3C2)CC1 |
| InChI | InChI=1S/C24H30Cl2N6O3S/c1-15-22(27-14-28-23(15)29-18-3-4-20(25)21(26)9-18)24(33)30-7-5-19(6-8-30)31-10-16-12-32(36(2,34)35)13-17(16)11-31/h3-4,9,14,16-17,19H,5-8,10-13H2,1-2H3,(H,27,28,29) |
| InChIKey | CBMFQMHVOININQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |