C24H29Cl2N5O3 — CID 78089227
[4-(3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]oxazin-1-yl)piperidin-1-yl]-[6-(3,4-dichloroanilino)-5-methylpyrimidin-4-yl]methanone (PubChem CID 78089227) has the molecular formula C24H29Cl2N5O3 and a molecular weight of 506.43 g/mol. Its IUPAC name is [4-(3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]oxazin-1-yl)piperidin-1-yl]-[6-(3,4-dichloroanilino)-5-methylpyrimidin-4-yl]methanone.
| Compound Name | [4-(3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]oxazin-1-yl)piperidin-1-yl]-[6-(3,4-dichloroanilino)-5-methylpyrimidin-4-yl]methanone |
|---|---|
| PubChem CID | 78089227 |
| Molecular Formula | C24H29Cl2N5O3 |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | [4-(3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]oxazin-1-yl)piperidin-1-yl]-[6-(3,4-dichloroanilino)-5-methylpyrimidin-4-yl]methanone |
| SMILES | Cc1c(Nc2ccc(Cl)c(Cl)c2)ncnc1C(=O)N1CCC(N2CCOC3COCCC32)CC1 |
| InChI | InChI=1S/C24H29Cl2N5O3/c1-15-22(27-14-28-23(15)29-16-2-3-18(25)19(26)12-16)24(32)30-7-4-17(5-8-30)31-9-11-34-21-13-33-10-6-20(21)31/h2-3,12,14,17,20-21H,4-11,13H2,1H3,(H,27,28,29) |
| InChIKey | OHTLUPJZVAEHHG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |