C17H23NO2 — CID 71503540
(1R,2S)-2-amino-1-(6-methoxynaphthalen-2-yl)hexan-1-ol (PubChem CID 71503540) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is (1R,2S)-2-amino-1-(6-methoxynaphthalen-2-yl)hexan-1-ol.
| Compound Name | (1R,2S)-2-amino-1-(6-methoxynaphthalen-2-yl)hexan-1-ol |
|---|---|
| PubChem CID | 71503540 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (1R,2S)-2-amino-1-(6-methoxynaphthalen-2-yl)hexan-1-ol |
| SMILES | CCCC[C@H](N)[C@H](O)c1ccc2cc(OC)ccc2c1 |
| InChI | InChI=1S/C17H23NO2/c1-3-4-5-16(18)17(19)14-7-6-13-11-15(20-2)9-8-12(13)10-14/h6-11,16-17,19H,3-5,18H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | SQGLKMROOOKZEJ-DLBZAZTESA-N |
| XLogP | 3.40 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |