C13H13F3N4 — CID 71503746
3-(aminomethyl)-N-(pyridin-4-ylmethyl)-6-(trifluoromethyl)pyridin-2-amine (PubChem CID 71503746) has the molecular formula C13H13F3N4 and a molecular weight of 282.27 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(pyridin-4-ylmethyl)-6-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 3-(aminomethyl)-N-(pyridin-4-ylmethyl)-6-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 71503746 |
| Molecular Formula | C13H13F3N4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 3-(aminomethyl)-N-(pyridin-4-ylmethyl)-6-(trifluoromethyl)pyridin-2-amine |
| SMILES | NCc1ccc(C(F)(F)F)nc1NCc1ccncc1 |
| InChI | InChI=1S/C13H13F3N4/c14-13(15,16)11-2-1-10(7-17)12(20-11)19-8-9-3-5-18-6-4-9/h1-6H,7-8,17H2,(H,19,20) |
| InChIKey | ZCBHPRYORKOOPZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |