C10H13F3N2 — CID 119054456
[2-propan-2-yl-6-(trifluoromethyl)-3-pyridinyl]methanamine (PubChem CID 119054456) has the molecular formula C10H13F3N2 and a molecular weight of 218.22 g/mol. Its IUPAC name is [2-propan-2-yl-6-(trifluoromethyl)-3-pyridinyl]methanamine.
| Compound Name | [2-propan-2-yl-6-(trifluoromethyl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 119054456 |
| Molecular Formula | C10H13F3N2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | [2-propan-2-yl-6-(trifluoromethyl)-3-pyridinyl]methanamine |
| SMILES | CC(C)c1nc(C(F)(F)F)ccc1CN |
| InChI | InChI=1S/C10H13F3N2/c1-6(2)9-7(5-14)3-4-8(15-9)10(11,12)13/h3-4,6H,5,14H2,1-2H3 |
| InChIKey | ZGGZGPFZLBSYBA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |