C14H13F3N2O2 — CID 79874080
[2-(4-methoxyphenoxy)-6-(trifluoromethyl)-3-pyridinyl]methanamine (PubChem CID 79874080) has the molecular formula C14H13F3N2O2 and a molecular weight of 298.26 g/mol. Its IUPAC name is [2-(4-methoxyphenoxy)-6-(trifluoromethyl)-3-pyridinyl]methanamine.
| Compound Name | [2-(4-methoxyphenoxy)-6-(trifluoromethyl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 79874080 |
| Molecular Formula | C14H13F3N2O2 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | [2-(4-methoxyphenoxy)-6-(trifluoromethyl)-3-pyridinyl]methanamine |
| SMILES | COc1ccc(Oc2nc(C(F)(F)F)ccc2CN)cc1 |
| InChI | InChI=1S/C14H13F3N2O2/c1-20-10-3-5-11(6-4-10)21-13-9(8-18)2-7-12(19-13)14(15,16)17/h2-7H,8,18H2,1H3 |
| InChIKey | LZXYZZGESRKGJX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |