C13H19F3N2O3 — CID 103176685
[2-[2-(3-methoxypropoxy)ethoxy]-6-(trifluoromethyl)-3-pyridinyl]methanamine (PubChem CID 103176685) has the molecular formula C13H19F3N2O3 and a molecular weight of 308.30 g/mol. Its IUPAC name is [2-[2-(3-methoxypropoxy)ethoxy]-6-(trifluoromethyl)-3-pyridinyl]methanamine.
| Compound Name | [2-[2-(3-methoxypropoxy)ethoxy]-6-(trifluoromethyl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 103176685 |
| Molecular Formula | C13H19F3N2O3 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | [2-[2-(3-methoxypropoxy)ethoxy]-6-(trifluoromethyl)-3-pyridinyl]methanamine |
| SMILES | COCCCOCCOc1nc(C(F)(F)F)ccc1CN |
| InChI | InChI=1S/C13H19F3N2O3/c1-19-5-2-6-20-7-8-21-12-10(9-17)3-4-11(18-12)13(14,15)16/h3-4H,2,5-9,17H2,1H3 |
| InChIKey | CSTOQPCPZRVXTK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|