C11H15F3N2O3 — CID 171929343
acetic acid;[2-ethoxy-6-(trifluoromethyl)-3-pyridinyl]methanamine (PubChem CID 171929343) has the molecular formula C11H15F3N2O3 and a molecular weight of 280.25 g/mol. Its IUPAC name is acetic acid;[2-ethoxy-6-(trifluoromethyl)-3-pyridinyl]methanamine.
| Compound Name | acetic acid;[2-ethoxy-6-(trifluoromethyl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 171929343 |
| Molecular Formula | C11H15F3N2O3 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | acetic acid;[2-ethoxy-6-(trifluoromethyl)-3-pyridinyl]methanamine |
| SMILES | CC(=O)O.CCOc1nc(C(F)(F)F)ccc1CN |
| InChI | InChI=1S/C9H11F3N2O.C2H4O2/c1-2-15-8-6(5-13)3-4-7(14-8)9(10,11)12;1-2(3)4/h3-4H,2,5,13H2,1H3;1H3,(H,3,4) |
| InChIKey | GQSJLNNWBNFYKJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |