C9H7F6NO — CID 133095206
2-ethoxy-3,6-bis(trifluoromethyl)pyridine (PubChem CID 133095206) has the molecular formula C9H7F6NO and a molecular weight of 259.15 g/mol. Its IUPAC name is 2-ethoxy-3,6-bis(trifluoromethyl)pyridine.
| Compound Name | 2-ethoxy-3,6-bis(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 133095206 |
| Molecular Formula | C9H7F6NO |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 2-ethoxy-3,6-bis(trifluoromethyl)pyridine |
| SMILES | CCOc1nc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C9H7F6NO/c1-2-17-7-5(8(10,11)12)3-4-6(16-7)9(13,14)15/h3-4H,2H2,1H3 |
| InChIKey | KZQYKAKTVBZKFU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |