About 2-ethoxy-3,6-bis(trifluoromethyl)pyridine
2-ethoxy-3,6-bis(trifluoromethyl)pyridine (PubChem CID 133095206) has the molecular formula C9H7F6NO
and a molecular weight of 259.15 g/mol. Its IUPAC name is 2-ethoxy-3,6-bis(trifluoromethyl)pyridine.
Molecular Properties
| Compound Name | 2-ethoxy-3,6-bis(trifluoromethyl)pyridine |
| PubChem CID | 133095206 |
| Molecular Formula | C9H7F6NO |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 2-ethoxy-3,6-bis(trifluoromethyl)pyridine |
| SMILES | CCOc1nc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C9H7F6NO/c1-2-17-7-5(8(10,11)12)3-4-6(16-7)9(13,14)15/h3-4H,2H2,1H3 |
| InChIKey | KZQYKAKTVBZKFU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethoxy-3,6-bis(trifluoromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-3,6-bis(trifluoromethyl)pyridine?
The IUPAC name of 2-ethoxy-3,6-bis(trifluoromethyl)pyridine (CID 133095206) is 2-ethoxy-3,6-bis(trifluoromethyl)pyridine.
What is the SMILES notation for 2-ethoxy-3,6-bis(trifluoromethyl)pyridine?
The canonical SMILES for 2-ethoxy-3,6-bis(trifluoromethyl)pyridine is CCOc1nc(C(F)(F)F)ccc1C(F)(F)F.
What is the InChIKey of 2-ethoxy-3,6-bis(trifluoromethyl)pyridine?
The InChIKey is KZQYKAKTVBZKFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F6NO/c1-2-17-7-5(8(10,11)12)3-4-6(16-7)9(13,14)15/h3-4H,2H2,1H3.
What are the key properties of 2-ethoxy-3,6-bis(trifluoromethyl)pyridine?
2-ethoxy-3,6-bis(trifluoromethyl)pyridine has a molecular weight of 259.15 g/mol, XLogP of 3.52, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-3,6-bis(trifluoromethyl)pyridine is sourced from PubChem (CID 133095206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).