C7H2F7N — CID 133095208
2-fluoro-3,6-bis(trifluoromethyl)pyridine (PubChem CID 133095208) has the molecular formula C7H2F7N and a molecular weight of 233.09 g/mol. Its IUPAC name is 2-fluoro-3,6-bis(trifluoromethyl)pyridine.
| Compound Name | 2-fluoro-3,6-bis(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 133095208 |
| Molecular Formula | C7H2F7N |
| Molecular Weight | 233.09 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | 2-fluoro-3,6-bis(trifluoromethyl)pyridine |
| SMILES | Fc1nc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C7H2F7N/c8-5-3(6(9,10)11)1-2-4(15-5)7(12,13)14/h1-2H |
| InChIKey | FQMWGZSXWROALP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.09 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|