C7H3F6N — CID 175919403
4-deuterio-2,6-bis(trifluoromethyl)pyridine (PubChem CID 175919403) has the molecular formula C7H3F6N and a molecular weight of 216.10 g/mol. Its IUPAC name is 4-deuterio-2,6-bis(trifluoromethyl)pyridine.
| Compound Name | 4-deuterio-2,6-bis(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 175919403 |
| Molecular Formula | C7H3F6N |
| Molecular Weight | 216.10 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 4-deuterio-2,6-bis(trifluoromethyl)pyridine |
| SMILES | [2H]c1cc(C(F)(F)F)nc(C(F)(F)F)c1 |
| InChI | InChI=1S/C7H3F6N/c8-6(9,10)4-2-1-3-5(14-4)7(11,12)13/h1-3H/i1D |
| InChIKey | YPDVFTXBESQIPJ-MICDWDOJSA-N |
| XLogP | 3.12 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.10 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |