C15H21F3N2O3 — CID 171924494
acetic acid;[2-(cyclopentylmethoxy)-6-(trifluoromethyl)-3-pyridinyl]methanamine (PubChem CID 171924494) has the molecular formula C15H21F3N2O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is acetic acid;[2-(cyclopentylmethoxy)-6-(trifluoromethyl)-3-pyridinyl]methanamine.
| Compound Name | acetic acid;[2-(cyclopentylmethoxy)-6-(trifluoromethyl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 171924494 |
| Molecular Formula | C15H21F3N2O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | acetic acid;[2-(cyclopentylmethoxy)-6-(trifluoromethyl)-3-pyridinyl]methanamine |
| SMILES | CC(=O)O.NCc1ccc(C(F)(F)F)nc1OCC1CCCC1 |
| InChI | InChI=1S/C13H17F3N2O.C2H4O2/c14-13(15,16)11-6-5-10(7-17)12(18-11)19-8-9-3-1-2-4-9;1-2(3)4/h5-6,9H,1-4,7-8,17H2;1H3,(H,3,4) |
| InChIKey | JNULULOBBFEOID-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |