C11H12F3N3O2 — CID 79876921
2-(cyclopropylmethoxy)-N'-hydroxy-6-(trifluoromethyl)pyridine-3-carboximidamide (PubChem CID 79876921) has the molecular formula C11H12F3N3O2 and a molecular weight of 275.23 g/mol. Its IUPAC name is 2-(cyclopropylmethoxy)-N'-hydroxy-6-(trifluoromethyl)pyridine-3-carboximidamide.
| Compound Name | 2-(cyclopropylmethoxy)-N'-hydroxy-6-(trifluoromethyl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 79876921 |
| Molecular Formula | C11H12F3N3O2 |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-(cyclopropylmethoxy)-N'-hydroxy-6-(trifluoromethyl)pyridine-3-carboximidamide |
| SMILES | NC(=NO)c1ccc(C(F)(F)F)nc1OCC1CC1 |
| InChI | InChI=1S/C11H12F3N3O2/c12-11(13,14)8-4-3-7(9(15)17-18)10(16-8)19-5-6-1-2-6/h3-4,6,18H,1-2,5H2,(H2,15,17) |
| InChIKey | MMWYPBBTWZVQLU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|