C12H16N2O2 — CID 76939071
2-(cyclopropylmethoxy)-N'-hydroxy-4-methylbenzenecarboximidamide (PubChem CID 76939071) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-(cyclopropylmethoxy)-N'-hydroxy-4-methylbenzenecarboximidamide.
| Compound Name | 2-(cyclopropylmethoxy)-N'-hydroxy-4-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 76939071 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2-(cyclopropylmethoxy)-N'-hydroxy-4-methylbenzenecarboximidamide |
| SMILES | Cc1ccc(C(N)=NO)c(OCC2CC2)c1 |
| InChI | InChI=1S/C12H16N2O2/c1-8-2-5-10(12(13)14-15)11(6-8)16-7-9-3-4-9/h2,5-6,9,15H,3-4,7H2,1H3,(H2,13,14) |
| InChIKey | CYIVJCBMGXKQLB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|