C11H13F3N4O2 — CID 79876784
N'-hydroxy-2-(3-hydroxypyrrolidin-1-yl)-6-(trifluoromethyl)pyridine-3-carboximidamide (PubChem CID 79876784) has the molecular formula C11H13F3N4O2 and a molecular weight of 290.25 g/mol. Its IUPAC name is N'-hydroxy-2-(3-hydroxypyrrolidin-1-yl)-6-(trifluoromethyl)pyridine-3-carboximidamide.
| Compound Name | N'-hydroxy-2-(3-hydroxypyrrolidin-1-yl)-6-(trifluoromethyl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 79876784 |
| Molecular Formula | C11H13F3N4O2 |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | N'-hydroxy-2-(3-hydroxypyrrolidin-1-yl)-6-(trifluoromethyl)pyridine-3-carboximidamide |
| SMILES | NC(=NO)c1ccc(C(F)(F)F)nc1N1CCC(O)C1 |
| InChI | InChI=1S/C11H13F3N4O2/c12-11(13,14)8-2-1-7(9(15)17-20)10(16-8)18-4-3-6(19)5-18/h1-2,6,19-20H,3-5H2,(H2,15,17) |
| InChIKey | OWBWUGGMMOMJQH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 94.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|