C13H14F3N3OS — CID 79874128
2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-6-(trifluoromethyl)pyridine-3-carbothioamide (PubChem CID 79874128) has the molecular formula C13H14F3N3OS and a molecular weight of 317.34 g/mol. Its IUPAC name is 2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-6-(trifluoromethyl)pyridine-3-carbothioamide.
| Compound Name | 2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-6-(trifluoromethyl)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 79874128 |
| Molecular Formula | C13H14F3N3OS |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-6-(trifluoromethyl)pyridine-3-carbothioamide |
| SMILES | NC(=S)c1ccc(C(F)(F)F)nc1N1CC2CCC(C1)O2 |
| InChI | InChI=1S/C13H14F3N3OS/c14-13(15,16)10-4-3-9(11(17)21)12(18-10)19-5-7-1-2-8(6-19)20-7/h3-4,7-8H,1-2,5-6H2,(H2,17,21) |
| InChIKey | INMCWBLWNZJCQX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|