C11H9F3N4O2S — CID 79874127
2-(3,5-dioxopiperazin-1-yl)-6-(trifluoromethyl)pyridine-3-carbothioamide (PubChem CID 79874127) has the molecular formula C11H9F3N4O2S and a molecular weight of 318.28 g/mol. Its IUPAC name is 2-(3,5-dioxopiperazin-1-yl)-6-(trifluoromethyl)pyridine-3-carbothioamide.
| Compound Name | 2-(3,5-dioxopiperazin-1-yl)-6-(trifluoromethyl)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 79874127 |
| Molecular Formula | C11H9F3N4O2S |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 2-(3,5-dioxopiperazin-1-yl)-6-(trifluoromethyl)pyridine-3-carbothioamide |
| SMILES | NC(=S)c1ccc(C(F)(F)F)nc1N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C11H9F3N4O2S/c12-11(13,14)6-2-1-5(9(15)21)10(16-6)18-3-7(19)17-8(20)4-18/h1-2H,3-4H2,(H2,15,21)(H,17,19,20) |
| InChIKey | RHQOGKBZKHNTSU-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|