C12H14F3N3OS — CID 103356160
2-(3-hydroxy-3-methylpyrrolidin-1-yl)-6-(trifluoromethyl)pyridine-3-carbothioamide (PubChem CID 103356160) has the molecular formula C12H14F3N3OS and a molecular weight of 305.32 g/mol. Its IUPAC name is 2-(3-hydroxy-3-methylpyrrolidin-1-yl)-6-(trifluoromethyl)pyridine-3-carbothioamide.
| Compound Name | 2-(3-hydroxy-3-methylpyrrolidin-1-yl)-6-(trifluoromethyl)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 103356160 |
| Molecular Formula | C12H14F3N3OS |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 2-(3-hydroxy-3-methylpyrrolidin-1-yl)-6-(trifluoromethyl)pyridine-3-carbothioamide |
| SMILES | CC1(O)CCN(c2nc(C(F)(F)F)ccc2C(N)=S)C1 |
| InChI | InChI=1S/C12H14F3N3OS/c1-11(19)4-5-18(6-11)10-7(9(16)20)2-3-8(17-10)12(13,14)15/h2-3,19H,4-6H2,1H3,(H2,16,20) |
| InChIKey | ICCUIOJCALTHCI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|