C15H20O5 — CID 71503831
dimethyl (1R,8aS)-1-methyl-3-oxo-1,2,6,7,8,8a-hexahydroazulene-5,5-dicarboxylate (PubChem CID 71503831) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is dimethyl (1R,8aS)-1-methyl-3-oxo-1,2,6,7,8,8a-hexahydroazulene-5,5-dicarboxylate.
| Compound Name | dimethyl (1R,8aS)-1-methyl-3-oxo-1,2,6,7,8,8a-hexahydroazulene-5,5-dicarboxylate |
|---|---|
| PubChem CID | 71503831 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | dimethyl (1R,8aS)-1-methyl-3-oxo-1,2,6,7,8,8a-hexahydroazulene-5,5-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C=C2C(=O)C[C@@H](C)[C@@H]2CCC1 |
| InChI | InChI=1S/C15H20O5/c1-9-7-12(16)11-8-15(13(17)19-2,14(18)20-3)6-4-5-10(9)11/h8-10H,4-7H2,1-3H3/t9-,10+/m1/s1 |
| InChIKey | WPBJSEULBFGWBQ-ZJUUUORDSA-N |
| XLogP | 1.65 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|