C27H21BrN2O3 — CID 71504514
(2E)-2-[(5-bromo-2-nitrophenyl)methylidene]-3-(2-phenyl-1H-indol-3-yl)cyclohexan-1-one (PubChem CID 71504514) has the molecular formula C27H21BrN2O3 and a molecular weight of 501.38 g/mol. Its IUPAC name is (2E)-2-[(5-bromo-2-nitrophenyl)methylidene]-3-(2-phenyl-1H-indol-3-yl)cyclohexan-1-one.
| Compound Name | (2E)-2-[(5-bromo-2-nitrophenyl)methylidene]-3-(2-phenyl-1H-indol-3-yl)cyclohexan-1-one |
|---|---|
| PubChem CID | 71504514 |
| Molecular Formula | C27H21BrN2O3 |
| Molecular Weight | 501.38 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | (2E)-2-[(5-bromo-2-nitrophenyl)methylidene]-3-(2-phenyl-1H-indol-3-yl)cyclohexan-1-one |
| SMILES | O=C1CCCC(c2c(-c3ccccc3)[nH]c3ccccc23)/C1=C\c1cc(Br)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H21BrN2O3/c28-19-13-14-24(30(32)33)18(15-19)16-22-20(10-6-12-25(22)31)26-21-9-4-5-11-23(21)29-27(26)17-7-2-1-3-8-17/h1-5,7-9,11,13-16,20,29H,6,10,12H2/b22-16+ |
| InChIKey | WXTPNRNPLLVTBS-CJLVFECKSA-N |
| XLogP | 7.43 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.38 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|