C20H32O3 — CID 71504665
ethyl (4E,8E)-2-acetyl-4,8,12-trimethyltrideca-4,8,12-trienoate (PubChem CID 71504665) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is ethyl (4E,8E)-2-acetyl-4,8,12-trimethyltrideca-4,8,12-trienoate.
| Compound Name | ethyl (4E,8E)-2-acetyl-4,8,12-trimethyltrideca-4,8,12-trienoate |
|---|---|
| PubChem CID | 71504665 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | ethyl (4E,8E)-2-acetyl-4,8,12-trimethyltrideca-4,8,12-trienoate |
| SMILES | C=C(C)CC/C=C(\C)CC/C=C(\C)CC(C(C)=O)C(=O)OCC |
| InChI | InChI=1S/C20H32O3/c1-7-23-20(22)19(18(6)21)14-17(5)13-9-12-16(4)11-8-10-15(2)3/h11,13,19H,2,7-10,12,14H2,1,3-6H3/b16-11+,17-13+ |
| InChIKey | KQWXHRGJCXUMKK-IUBLYSDUSA-N |
| XLogP | 5.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|